C20H24ClN3O — CID 125168048
N-[(2R)-2-(azepan-1-yl)-2-phenylethyl]-3-chloropyridine-4-carboxamide (PubChem CID 125168048) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is N-[(2R)-2-(azepan-1-yl)-2-phenylethyl]-3-chloropyridine-4-carboxamide.
| Compound Name | N-[(2R)-2-(azepan-1-yl)-2-phenylethyl]-3-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 125168048 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-[(2R)-2-(azepan-1-yl)-2-phenylethyl]-3-chloropyridine-4-carboxamide |
| SMILES | O=C(NC[C@@H](c1ccccc1)N1CCCCCC1)c1ccncc1Cl |
| InChI | InChI=1S/C20H24ClN3O/c21-18-14-22-11-10-17(18)20(25)23-15-19(16-8-4-3-5-9-16)24-12-6-1-2-7-13-24/h3-5,8-11,14,19H,1-2,6-7,12-13,15H2,(H,23,25)/t19-/m0/s1 |
| InChIKey | IUXWIQMFSCFAIV-IBGZPJMESA-N |
| XLogP | 4.08 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |