C20H23FN4O4 — CID 55821053
2-amino-5-fluoro-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-nitrobenzamide (PubChem CID 55821053) has the molecular formula C20H23FN4O4 and a molecular weight of 402.43 g/mol. Its IUPAC name is 2-amino-5-fluoro-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-nitrobenzamide.
| Compound Name | 2-amino-5-fluoro-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55821053 |
| Molecular Formula | C20H23FN4O4 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-amino-5-fluoro-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-nitrobenzamide |
| SMILES | COc1ccccc1C(CNC(=O)c1cc(F)cc([N+](=O)[O-])c1N)N1CCCC1 |
| InChI | InChI=1S/C20H23FN4O4/c1-29-18-7-3-2-6-14(18)17(24-8-4-5-9-24)12-23-20(26)15-10-13(21)11-16(19(15)22)25(27)28/h2-3,6-7,10-11,17H,4-5,8-9,12,22H2,1H3,(H,23,26) |
| InChIKey | JRZIDSAWPIBPMA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|