C21H29Cl2N3O2 — CID 119946536
2-amino-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]benzamide;dihydrochloride (PubChem CID 119946536) has the molecular formula C21H29Cl2N3O2 and a molecular weight of 426.39 g/mol. Its IUPAC name is 2-amino-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]benzamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119946536 |
| Molecular Formula | C21H29Cl2N3O2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-amino-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]benzamide;dihydrochloride |
| SMILES | COc1ccccc1C(CNC(=O)c1ccccc1N)N1CCCCC1.Cl.Cl |
| InChI | InChI=1S/C21H27N3O2.2ClH/c1-26-20-12-6-4-10-17(20)19(24-13-7-2-8-14-24)15-23-21(25)16-9-3-5-11-18(16)22;;/h3-6,9-12,19H,2,7-8,13-15,22H2,1H3,(H,23,25);2*1H |
| InChIKey | NBJXQNMPLRFIKN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|