C23H23F2N3O3S — CID 43018910
N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-[(4-fluorophenyl)sulfamoyl]benzamide (PubChem CID 43018910) has the molecular formula C23H23F2N3O3S and a molecular weight of 459.52 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-[(4-fluorophenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-[(4-fluorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 43018910 |
| Molecular Formula | C23H23F2N3O3S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-[(4-fluorophenyl)sulfamoyl]benzamide |
| SMILES | CN(C)C(CNC(=O)c1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C23H23F2N3O3S/c1-28(2)22(17-4-3-5-19(25)14-17)15-26-23(29)16-6-12-21(13-7-16)32(30,31)27-20-10-8-18(24)9-11-20/h3-14,22,27H,15H2,1-2H3,(H,26,29) |
| InChIKey | JKWZUYQCNHOMKN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |