C21H22FN3O3S2 — CID 55588965
N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-3-[(4-fluorophenyl)sulfamoyl]benzamide (PubChem CID 55588965) has the molecular formula C21H22FN3O3S2 and a molecular weight of 447.56 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-3-[(4-fluorophenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-3-[(4-fluorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55588965 |
| Molecular Formula | C21H22FN3O3S2 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-3-ylethyl]-3-[(4-fluorophenyl)sulfamoyl]benzamide |
| SMILES | CN(C)C(CNC(=O)c1cccc(S(=O)(=O)Nc2ccc(F)cc2)c1)c1ccsc1 |
| InChI | InChI=1S/C21H22FN3O3S2/c1-25(2)20(16-10-11-29-14-16)13-23-21(26)15-4-3-5-19(12-15)30(27,28)24-18-8-6-17(22)7-9-18/h3-12,14,20,24H,13H2,1-2H3,(H,23,26) |
| InChIKey | HHFJCCPBBZZIQO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |