C24H30N4O2S2 — CID 46592184
1-N,4-N-bis[2-(dimethylamino)-2-thiophen-3-ylethyl]benzene-1,4-dicarboxamide (PubChem CID 46592184) has the molecular formula C24H30N4O2S2 and a molecular weight of 470.66 g/mol. Its IUPAC name is 1-N,4-N-bis[2-(dimethylamino)-2-thiophen-3-ylethyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[2-(dimethylamino)-2-thiophen-3-ylethyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 46592184 |
| Molecular Formula | C24H30N4O2S2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 1-N,4-N-bis[2-(dimethylamino)-2-thiophen-3-ylethyl]benzene-1,4-dicarboxamide |
| SMILES | CN(C)C(CNC(=O)c1ccc(C(=O)NCC(c2ccsc2)N(C)C)cc1)c1ccsc1 |
| InChI | InChI=1S/C24H30N4O2S2/c1-27(2)21(19-9-11-31-15-19)13-25-23(29)17-5-7-18(8-6-17)24(30)26-14-22(28(3)4)20-10-12-32-16-20/h5-12,15-16,21-22H,13-14H2,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | QGKZLYLFFUSTCW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |