C14H18N2OS2 — CID 32630977
N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]-5-methylthiophene-2-carboxamide (PubChem CID 32630977) has the molecular formula C14H18N2OS2 and a molecular weight of 294.45 g/mol. Its IUPAC name is N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 32630977 |
| Molecular Formula | C14H18N2OS2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC[C@@H](c2ccsc2)N(C)C)s1 |
| InChI | InChI=1S/C14H18N2OS2/c1-10-4-5-13(19-10)14(17)15-8-12(16(2)3)11-6-7-18-9-11/h4-7,9,12H,8H2,1-3H3,(H,15,17)/t12-/m0/s1 |
| InChIKey | VOGFTDISLBDLOU-LBPRGKRZSA-N |
| XLogP | 3.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |