C24H26FN3O3S — CID 24818233
N-[2-(dimethylamino)-2-phenylethyl]-4-[(4-fluoro-3-methylphenyl)sulfonylamino]benzamide (PubChem CID 24818233) has the molecular formula C24H26FN3O3S and a molecular weight of 455.56 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-phenylethyl]-4-[(4-fluoro-3-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[2-(dimethylamino)-2-phenylethyl]-4-[(4-fluoro-3-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 24818233 |
| Molecular Formula | C24H26FN3O3S |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-[2-(dimethylamino)-2-phenylethyl]-4-[(4-fluoro-3-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(C(=O)NCC(c3ccccc3)N(C)C)cc2)ccc1F |
| InChI | InChI=1S/C24H26FN3O3S/c1-17-15-21(13-14-22(17)25)32(30,31)27-20-11-9-19(10-12-20)24(29)26-16-23(28(2)3)18-7-5-4-6-8-18/h4-15,23,27H,16H2,1-3H3,(H,26,29) |
| InChIKey | WNVKPOUWLLGNSR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |