C22H28FN3O4S — CID 24640053
N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide (PubChem CID 24640053) has the molecular formula C22H28FN3O4S and a molecular weight of 449.55 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24640053 |
| Molecular Formula | C22H28FN3O4S |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide |
| SMILES | CN(C)C(CNC(=O)c1ccc(S(=O)(=O)NCC2CCCO2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H28FN3O4S/c1-26(2)21(17-5-3-6-18(23)13-17)15-24-22(27)16-8-10-20(11-9-16)31(28,29)25-14-19-7-4-12-30-19/h3,5-6,8-11,13,19,21,25H,4,7,12,14-15H2,1-2H3,(H,24,27) |
| InChIKey | LQWFHAQGKCHBDC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |