C19H26Cl2FN3O — CID 120612427
3-(2-aminophenyl)-N-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]propanamide;dihydrochloride (PubChem CID 120612427) has the molecular formula C19H26Cl2FN3O and a molecular weight of 402.34 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]propanamide;dihydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120612427 |
| Molecular Formula | C19H26Cl2FN3O |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-(2-aminophenyl)-N-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]propanamide;dihydrochloride |
| SMILES | CN(C)C(CNC(=O)CCc1ccccc1N)c1ccc(F)cc1.Cl.Cl |
| InChI | InChI=1S/C19H24FN3O.2ClH/c1-23(2)18(15-7-10-16(20)11-8-15)13-22-19(24)12-9-14-5-3-4-6-17(14)21;;/h3-8,10-11,18H,9,12-13,21H2,1-2H3,(H,22,24);2*1H |
| InChIKey | JMOSPYFHAUPKMP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|