C18H19F2NO — CID 110279623
3-(2-fluorophenyl)-N-[2-(4-fluorophenyl)propyl]propanamide (PubChem CID 110279623) has the molecular formula C18H19F2NO and a molecular weight of 303.35 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-[2-(4-fluorophenyl)propyl]propanamide.
| Compound Name | 3-(2-fluorophenyl)-N-[2-(4-fluorophenyl)propyl]propanamide |
|---|---|
| PubChem CID | 110279623 |
| Molecular Formula | C18H19F2NO |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 3-(2-fluorophenyl)-N-[2-(4-fluorophenyl)propyl]propanamide |
| SMILES | CC(CNC(=O)CCc1ccccc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H19F2NO/c1-13(14-6-9-16(19)10-7-14)12-21-18(22)11-8-15-4-2-3-5-17(15)20/h2-7,9-10,13H,8,11-12H2,1H3,(H,21,22) |
| InChIKey | DFTZJOFPJURSCL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |