C18H19FN2O3S — CID 9417849
N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-(2-methoxyphenyl)propanehydrazide (PubChem CID 9417849) has the molecular formula C18H19FN2O3S and a molecular weight of 362.43 g/mol. Its IUPAC name is N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-(2-methoxyphenyl)propanehydrazide.
| Compound Name | N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-(2-methoxyphenyl)propanehydrazide |
|---|---|
| PubChem CID | 9417849 |
| Molecular Formula | C18H19FN2O3S |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N'-[2-(2-fluorophenyl)sulfanylacetyl]-3-(2-methoxyphenyl)propanehydrazide |
| SMILES | COc1ccccc1CCC(=O)NNC(=O)CSc1ccccc1F |
| InChI | InChI=1S/C18H19FN2O3S/c1-24-15-8-4-2-6-13(15)10-11-17(22)20-21-18(23)12-25-16-9-5-3-7-14(16)19/h2-9H,10-12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | WNCWPXGEHCASPU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|