C18H16FN3O3S — CID 9428837
3-(1,3-benzoxazol-2-yl)-N'-[2-(2-fluorophenyl)sulfanylacetyl]propanehydrazide (PubChem CID 9428837) has the molecular formula C18H16FN3O3S and a molecular weight of 373.41 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-N'-[2-(2-fluorophenyl)sulfanylacetyl]propanehydrazide.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-N'-[2-(2-fluorophenyl)sulfanylacetyl]propanehydrazide |
|---|---|
| PubChem CID | 9428837 |
| Molecular Formula | C18H16FN3O3S |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-N'-[2-(2-fluorophenyl)sulfanylacetyl]propanehydrazide |
| SMILES | O=C(CCc1nc2ccccc2o1)NNC(=O)CSc1ccccc1F |
| InChI | InChI=1S/C18H16FN3O3S/c19-12-5-1-4-8-15(12)26-11-17(24)22-21-16(23)9-10-18-20-13-6-2-3-7-14(13)25-18/h1-8H,9-11H2,(H,21,23)(H,22,24) |
| InChIKey | CXVFNOZZUNRDFF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|