C20H17FN2O3S — CID 24641286
N'-[2-(2-fluorophenyl)sulfanylacetyl]-2-naphthalen-1-yloxyacetohydrazide (PubChem CID 24641286) has the molecular formula C20H17FN2O3S and a molecular weight of 384.43 g/mol. Its IUPAC name is N'-[2-(2-fluorophenyl)sulfanylacetyl]-2-naphthalen-1-yloxyacetohydrazide.
| Compound Name | N'-[2-(2-fluorophenyl)sulfanylacetyl]-2-naphthalen-1-yloxyacetohydrazide |
|---|---|
| PubChem CID | 24641286 |
| Molecular Formula | C20H17FN2O3S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N'-[2-(2-fluorophenyl)sulfanylacetyl]-2-naphthalen-1-yloxyacetohydrazide |
| SMILES | O=C(COc1cccc2ccccc12)NNC(=O)CSc1ccccc1F |
| InChI | InChI=1S/C20H17FN2O3S/c21-16-9-3-4-11-18(16)27-13-20(25)23-22-19(24)12-26-17-10-5-7-14-6-1-2-8-15(14)17/h1-11H,12-13H2,(H,22,24)(H,23,25) |
| InChIKey | XTMLHIUGBPEZQV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|