C20H16F2N2O2S — CID 41264220
N'-[2-(2,4-difluorophenyl)sulfanylacetyl]-2-naphthalen-1-ylacetohydrazide (PubChem CID 41264220) has the molecular formula C20H16F2N2O2S and a molecular weight of 386.42 g/mol. Its IUPAC name is N'-[2-(2,4-difluorophenyl)sulfanylacetyl]-2-naphthalen-1-ylacetohydrazide.
| Compound Name | N'-[2-(2,4-difluorophenyl)sulfanylacetyl]-2-naphthalen-1-ylacetohydrazide |
|---|---|
| PubChem CID | 41264220 |
| Molecular Formula | C20H16F2N2O2S |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N'-[2-(2,4-difluorophenyl)sulfanylacetyl]-2-naphthalen-1-ylacetohydrazide |
| SMILES | O=C(CSc1ccc(F)cc1F)NNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C20H16F2N2O2S/c21-15-8-9-18(17(22)11-15)27-12-20(26)24-23-19(25)10-14-6-3-5-13-4-1-2-7-16(13)14/h1-9,11H,10,12H2,(H,23,25)(H,24,26) |
| InChIKey | KLFVQOTWLXOFIN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|