C17H16F2N2O3S — CID 9320723
N'-[2-(2,5-difluorophenyl)sulfanylacetyl]-2-(2-methylphenoxy)acetohydrazide (PubChem CID 9320723) has the molecular formula C17H16F2N2O3S and a molecular weight of 366.39 g/mol. Its IUPAC name is N'-[2-(2,5-difluorophenyl)sulfanylacetyl]-2-(2-methylphenoxy)acetohydrazide.
| Compound Name | N'-[2-(2,5-difluorophenyl)sulfanylacetyl]-2-(2-methylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 9320723 |
| Molecular Formula | C17H16F2N2O3S |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N'-[2-(2,5-difluorophenyl)sulfanylacetyl]-2-(2-methylphenoxy)acetohydrazide |
| SMILES | Cc1ccccc1OCC(=O)NNC(=O)CSc1cc(F)ccc1F |
| InChI | InChI=1S/C17H16F2N2O3S/c1-11-4-2-3-5-14(11)24-9-16(22)20-21-17(23)10-25-15-8-12(18)6-7-13(15)19/h2-8H,9-10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | MDSODDGZTLAMCM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|