C11H13FN2O3S — CID 9471875
2-(2-fluorophenoxy)-N'-(2-methylsulfanylacetyl)acetohydrazide (PubChem CID 9471875) has the molecular formula C11H13FN2O3S and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N'-(2-methylsulfanylacetyl)acetohydrazide.
| Compound Name | 2-(2-fluorophenoxy)-N'-(2-methylsulfanylacetyl)acetohydrazide |
|---|---|
| PubChem CID | 9471875 |
| Molecular Formula | C11H13FN2O3S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-(2-fluorophenoxy)-N'-(2-methylsulfanylacetyl)acetohydrazide |
| SMILES | CSCC(=O)NNC(=O)COc1ccccc1F |
| InChI | InChI=1S/C11H13FN2O3S/c1-18-7-11(16)14-13-10(15)6-17-9-5-3-2-4-8(9)12/h2-5H,6-7H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | AWXLBMOWIVZSQN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|