C15H15FN2O3S2 — CID 8636119
2-(2-fluorophenoxy)-N'-[2-(thiophen-2-ylmethylsulfanyl)acetyl]acetohydrazide (PubChem CID 8636119) has the molecular formula C15H15FN2O3S2 and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N'-[2-(thiophen-2-ylmethylsulfanyl)acetyl]acetohydrazide.
| Compound Name | 2-(2-fluorophenoxy)-N'-[2-(thiophen-2-ylmethylsulfanyl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 8636119 |
| Molecular Formula | C15H15FN2O3S2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2-(2-fluorophenoxy)-N'-[2-(thiophen-2-ylmethylsulfanyl)acetyl]acetohydrazide |
| SMILES | O=C(COc1ccccc1F)NNC(=O)CSCc1cccs1 |
| InChI | InChI=1S/C15H15FN2O3S2/c16-12-5-1-2-6-13(12)21-8-14(19)17-18-15(20)10-22-9-11-4-3-7-23-11/h1-7H,8-10H2,(H,17,19)(H,18,20) |
| InChIKey | MFEVBAXAUQZVRH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|