C13H11FN2O2S — CID 3895307
2-(2-fluorophenoxy)-N-(thiophen-2-ylmethylideneamino)acetamide (PubChem CID 3895307) has the molecular formula C13H11FN2O2S and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-(thiophen-2-ylmethylideneamino)acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-(thiophen-2-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 3895307 |
| Molecular Formula | C13H11FN2O2S |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-(thiophen-2-ylmethylideneamino)acetamide |
| SMILES | O=C(COc1ccccc1F)NN=Cc1cccs1 |
| InChI | InChI=1S/C13H11FN2O2S/c14-11-5-1-2-6-12(11)18-9-13(17)16-15-8-10-4-3-7-19-10/h1-8H,9H2,(H,16,17) |
| InChIKey | DALAOINJYUMMGP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|