C15H15IN2O2S — CID 5446377
2-(4-iodo-2,6-dimethylphenoxy)-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide (PubChem CID 5446377) has the molecular formula C15H15IN2O2S and a molecular weight of 414.27 g/mol. Its IUPAC name is 2-(4-iodo-2,6-dimethylphenoxy)-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide.
| Compound Name | 2-(4-iodo-2,6-dimethylphenoxy)-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 5446377 |
| Molecular Formula | C15H15IN2O2S |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 2-(4-iodo-2,6-dimethylphenoxy)-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| SMILES | Cc1cc(I)cc(C)c1OCC(=O)N/N=C\c1cccs1 |
| InChI | InChI=1S/C15H15IN2O2S/c1-10-6-12(16)7-11(2)15(10)20-9-14(19)18-17-8-13-4-3-5-21-13/h3-8H,9H2,1-2H3,(H,18,19)/b17-8- |
| InChIKey | CPBLMRGPXFYILG-IUXPMGMMSA-N |
| XLogP | 3.50 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|