C15H15IN2O3 — CID 6040206
N-[(E)-furan-2-ylmethylideneamino]-2-(4-iodo-2,6-dimethylphenoxy)acetamide (PubChem CID 6040206) has the molecular formula C15H15IN2O3 and a molecular weight of 398.20 g/mol. Its IUPAC name is N-[(E)-furan-2-ylmethylideneamino]-2-(4-iodo-2,6-dimethylphenoxy)acetamide.
| Compound Name | N-[(E)-furan-2-ylmethylideneamino]-2-(4-iodo-2,6-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 6040206 |
| Molecular Formula | C15H15IN2O3 |
| Molecular Weight | 398.20 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | N-[(E)-furan-2-ylmethylideneamino]-2-(4-iodo-2,6-dimethylphenoxy)acetamide |
| SMILES | Cc1cc(I)cc(C)c1OCC(=O)N/N=C/c1ccco1 |
| InChI | InChI=1S/C15H15IN2O3/c1-10-6-12(16)7-11(2)15(10)21-9-14(19)18-17-8-13-4-3-5-20-13/h3-8H,9H2,1-2H3,(H,18,19)/b17-8+ |
| InChIKey | IQRWDISPMZOQHD-CAOOACKPSA-N |
| XLogP | 3.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|