C13H11FN2O3 — CID 5368979
2-(4-fluorophenoxy)-N-[(Z)-furan-2-ylmethylideneamino]acetamide (PubChem CID 5368979) has the molecular formula C13H11FN2O3 and a molecular weight of 262.24 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-[(Z)-furan-2-ylmethylideneamino]acetamide.
| Compound Name | 2-(4-fluorophenoxy)-N-[(Z)-furan-2-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 5368979 |
| Molecular Formula | C13H11FN2O3 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-[(Z)-furan-2-ylmethylideneamino]acetamide |
| SMILES | O=C(COc1ccc(F)cc1)N/N=C\c1ccco1 |
| InChI | InChI=1S/C13H11FN2O3/c14-10-3-5-11(6-4-10)19-9-13(17)16-15-8-12-2-1-7-18-12/h1-8H,9H2,(H,16,17)/b15-8- |
| InChIKey | XSPUNVPURIIVQU-NVNXTCNLSA-N |
| XLogP | 1.95 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|