C16H18N2O3 — CID 832440
N-(furan-2-ylmethylideneamino)-2-(2,4,6-trimethylphenoxy)acetamide (PubChem CID 832440) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-(furan-2-ylmethylideneamino)-2-(2,4,6-trimethylphenoxy)acetamide.
| Compound Name | N-(furan-2-ylmethylideneamino)-2-(2,4,6-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 832440 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-(furan-2-ylmethylideneamino)-2-(2,4,6-trimethylphenoxy)acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)NN=Cc2ccco2)c(C)c1 |
| InChI | InChI=1S/C16H18N2O3/c1-11-7-12(2)16(13(3)8-11)21-10-15(19)18-17-9-14-5-4-6-20-14/h4-9H,10H2,1-3H3,(H,18,19) |
| InChIKey | CIESUVJYMQWROD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|