C8H11NOS2 — CID 60645758
N-methyl-2-(thiophen-2-ylmethylsulfanyl)acetamide (PubChem CID 60645758) has the molecular formula C8H11NOS2 and a molecular weight of 201.32 g/mol. Its IUPAC name is N-methyl-2-(thiophen-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-methyl-2-(thiophen-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 60645758 |
| Molecular Formula | C8H11NOS2 |
| Molecular Weight | 201.32 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | N-methyl-2-(thiophen-2-ylmethylsulfanyl)acetamide |
| SMILES | CNC(=O)CSCc1cccs1 |
| InChI | InChI=1S/C8H11NOS2/c1-9-8(10)6-11-5-7-3-2-4-12-7/h2-4H,5-6H2,1H3,(H,9,10) |
| InChIKey | LIMSHNSJUYRSNY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |