C14H14FNOS2 — CID 8639932
N-(4-fluoro-2-methylphenyl)-2-(thiophen-2-ylmethylsulfanyl)acetamide (PubChem CID 8639932) has the molecular formula C14H14FNOS2 and a molecular weight of 295.40 g/mol. Its IUPAC name is N-(4-fluoro-2-methylphenyl)-2-(thiophen-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-(4-fluoro-2-methylphenyl)-2-(thiophen-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 8639932 |
| Molecular Formula | C14H14FNOS2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | N-(4-fluoro-2-methylphenyl)-2-(thiophen-2-ylmethylsulfanyl)acetamide |
| SMILES | Cc1cc(F)ccc1NC(=O)CSCc1cccs1 |
| InChI | InChI=1S/C14H14FNOS2/c1-10-7-11(15)4-5-13(10)16-14(17)9-18-8-12-3-2-6-19-12/h2-7H,8-9H2,1H3,(H,16,17) |
| InChIKey | WRKJAIFJXVRQHT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |