C12H11NO3S3 — CID 43358114
3-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]thiophene-2-carboxylic acid (PubChem CID 43358114) has the molecular formula C12H11NO3S3 and a molecular weight of 313.43 g/mol. Its IUPAC name is 3-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]thiophene-2-carboxylic acid.
| Compound Name | 3-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43358114 |
| Molecular Formula | C12H11NO3S3 |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 3-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]thiophene-2-carboxylic acid |
| SMILES | O=C(CSCc1cccs1)Nc1ccsc1C(=O)O |
| InChI | InChI=1S/C12H11NO3S3/c14-10(7-17-6-8-2-1-4-18-8)13-9-3-5-19-11(9)12(15)16/h1-5H,6-7H2,(H,13,14)(H,15,16) |
| InChIKey | MYUNJKSIUHGDPA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |