C10H13NO3S2 — CID 78972918
(2R)-2-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]propanoic acid (PubChem CID 78972918) has the molecular formula C10H13NO3S2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (2R)-2-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 78972918 |
| Molecular Formula | C10H13NO3S2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | (2R)-2-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)CSCc1cccs1)C(=O)O |
| InChI | InChI=1S/C10H13NO3S2/c1-7(10(13)14)11-9(12)6-15-5-8-3-2-4-16-8/h2-4,7H,5-6H2,1H3,(H,11,12)(H,13,14)/t7-/m1/s1 |
| InChIKey | XQXLVJIETZCSEU-SSDOTTSWSA-N |
| XLogP | 1.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |