C11H15NO4S2 — CID 66171992
2-hydroxy-2-methyl-3-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]propanoic acid (PubChem CID 66171992) has the molecular formula C11H15NO4S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 66171992 |
| Molecular Formula | C11H15NO4S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 2-hydroxy-2-methyl-3-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]propanoic acid |
| SMILES | CC(O)(CNC(=O)CSCc1cccs1)C(=O)O |
| InChI | InChI=1S/C11H15NO4S2/c1-11(16,10(14)15)7-12-9(13)6-17-5-8-3-2-4-18-8/h2-4,16H,5-7H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | VGXZCHGGYOMXJW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |