C13H15NO4S — CID 119238424
(2S)-2-[(2-phenacylsulfanylacetyl)amino]propanoic acid (PubChem CID 119238424) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is (2S)-2-[(2-phenacylsulfanylacetyl)amino]propanoic acid.
| Compound Name | (2S)-2-[(2-phenacylsulfanylacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119238424 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (2S)-2-[(2-phenacylsulfanylacetyl)amino]propanoic acid |
| SMILES | C[C@H](NC(=O)CSCC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H15NO4S/c1-9(13(17)18)14-12(16)8-19-7-11(15)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,14,16)(H,17,18)/t9-/m0/s1 |
| InChIKey | WXXHZVSWIAKGIK-VIFPVBQESA-N |
| XLogP | 1.19 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |