C18H18N2O3S — CID 95278001
(2R)-2-[(2-phenacylsulfanylacetyl)amino]-2-phenylacetamide (PubChem CID 95278001) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is (2R)-2-[(2-phenacylsulfanylacetyl)amino]-2-phenylacetamide.
| Compound Name | (2R)-2-[(2-phenacylsulfanylacetyl)amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 95278001 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (2R)-2-[(2-phenacylsulfanylacetyl)amino]-2-phenylacetamide |
| SMILES | NC(=O)[C@H](NC(=O)CSCC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O3S/c19-18(23)17(14-9-5-2-6-10-14)20-16(22)12-24-11-15(21)13-7-3-1-4-8-13/h1-10,17H,11-12H2,(H2,19,23)(H,20,22)/t17-/m1/s1 |
| InChIKey | IDQVQRNZMNGYAY-QGZVFWFLSA-N |
| XLogP | 1.95 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |