C15H19NO4S — CID 119369606
(2R)-3-methyl-2-[(2-phenacylsulfanylacetyl)amino]butanoic acid (PubChem CID 119369606) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is (2R)-3-methyl-2-[(2-phenacylsulfanylacetyl)amino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[(2-phenacylsulfanylacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119369606 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (2R)-3-methyl-2-[(2-phenacylsulfanylacetyl)amino]butanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)CSCC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H19NO4S/c1-10(2)14(15(19)20)16-13(18)9-21-8-12(17)11-6-4-3-5-7-11/h3-7,10,14H,8-9H2,1-2H3,(H,16,18)(H,19,20)/t14-/m1/s1 |
| InChIKey | DDJJGRSAKGVQKI-CQSZACIVSA-N |
| XLogP | 1.83 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |