C20H21NO4S — CID 84557031
3-methyl-2-[(3-phenacylsulfanylbenzoyl)amino]butanoic acid (PubChem CID 84557031) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is 3-methyl-2-[(3-phenacylsulfanylbenzoyl)amino]butanoic acid.
| Compound Name | 3-methyl-2-[(3-phenacylsulfanylbenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 84557031 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 3-methyl-2-[(3-phenacylsulfanylbenzoyl)amino]butanoic acid |
| SMILES | CC(C)C(NC(=O)c1cccc(SCC(=O)c2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C20H21NO4S/c1-13(2)18(20(24)25)21-19(23)15-9-6-10-16(11-15)26-12-17(22)14-7-4-3-5-8-14/h3-11,13,18H,12H2,1-2H3,(H,21,23)(H,24,25) |
| InChIKey | JNBWLRAYBAXGDA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |