C23H21NO2S — CID 84552506
N-(2-ethylphenyl)-3-phenacylsulfanylbenzamide (PubChem CID 84552506) has the molecular formula C23H21NO2S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-(2-ethylphenyl)-3-phenacylsulfanylbenzamide.
| Compound Name | N-(2-ethylphenyl)-3-phenacylsulfanylbenzamide |
|---|---|
| PubChem CID | 84552506 |
| Molecular Formula | C23H21NO2S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-(2-ethylphenyl)-3-phenacylsulfanylbenzamide |
| SMILES | CCc1ccccc1NC(=O)c1cccc(SCC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H21NO2S/c1-2-17-9-6-7-14-21(17)24-23(26)19-12-8-13-20(15-19)27-16-22(25)18-10-4-3-5-11-18/h3-15H,2,16H2,1H3,(H,24,26) |
| InChIKey | HAODRTSKQPSQCP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |