C19H17N3O2S2 — CID 84560916
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-phenacylsulfanylbenzamide (PubChem CID 84560916) has the molecular formula C19H17N3O2S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-phenacylsulfanylbenzamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-phenacylsulfanylbenzamide |
|---|---|
| PubChem CID | 84560916 |
| Molecular Formula | C19H17N3O2S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-phenacylsulfanylbenzamide |
| SMILES | CCc1nnc(NC(=O)c2cccc(SCC(=O)c3ccccc3)c2)s1 |
| InChI | InChI=1S/C19H17N3O2S2/c1-2-17-21-22-19(26-17)20-18(24)14-9-6-10-15(11-14)25-12-16(23)13-7-4-3-5-8-13/h3-11H,2,12H2,1H3,(H,20,22,24) |
| InChIKey | DHZGKWPNKNOLTF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |