C19H16N2O3S — CID 84552661
N-(5-methyl-1,2-oxazol-3-yl)-3-phenacylsulfanylbenzamide (PubChem CID 84552661) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-3-phenacylsulfanylbenzamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-3-phenacylsulfanylbenzamide |
|---|---|
| PubChem CID | 84552661 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-3-phenacylsulfanylbenzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(SCC(=O)c3ccccc3)c2)no1 |
| InChI | InChI=1S/C19H16N2O3S/c1-13-10-18(21-24-13)20-19(23)15-8-5-9-16(11-15)25-12-17(22)14-6-3-2-4-7-14/h2-11H,12H2,1H3,(H,20,21,23) |
| InChIKey | RKDAEYLTWHOEHG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |