C20H14Cl2N2O2S — CID 84560928
N-(3,5-dichloro-2-pyridinyl)-3-phenacylsulfanylbenzamide (PubChem CID 84560928) has the molecular formula C20H14Cl2N2O2S and a molecular weight of 417.32 g/mol. Its IUPAC name is N-(3,5-dichloro-2-pyridinyl)-3-phenacylsulfanylbenzamide.
| Compound Name | N-(3,5-dichloro-2-pyridinyl)-3-phenacylsulfanylbenzamide |
|---|---|
| PubChem CID | 84560928 |
| Molecular Formula | C20H14Cl2N2O2S |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | N-(3,5-dichloro-2-pyridinyl)-3-phenacylsulfanylbenzamide |
| SMILES | O=C(CSc1cccc(C(=O)Nc2ncc(Cl)cc2Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C20H14Cl2N2O2S/c21-15-10-17(22)19(23-11-15)24-20(26)14-7-4-8-16(9-14)27-12-18(25)13-5-2-1-3-6-13/h1-11H,12H2,(H,23,24,26) |
| InChIKey | CDOTVKGTPBJLJG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |