C18H17NO4S — CID 84557002
2-[(3-phenacylsulfanylbenzoyl)amino]propanoic acid (PubChem CID 84557002) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-[(3-phenacylsulfanylbenzoyl)amino]propanoic acid.
| Compound Name | 2-[(3-phenacylsulfanylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 84557002 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-[(3-phenacylsulfanylbenzoyl)amino]propanoic acid |
| SMILES | CC(NC(=O)c1cccc(SCC(=O)c2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C18H17NO4S/c1-12(18(22)23)19-17(21)14-8-5-9-15(10-14)24-11-16(20)13-6-3-2-4-7-13/h2-10,12H,11H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | NCBMLFPFBUAJDG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |