C17H17NO2S — CID 84558154
N,N-dimethyl-3-phenacylsulfanylbenzamide (PubChem CID 84558154) has the molecular formula C17H17NO2S and a molecular weight of 299.39 g/mol. Its IUPAC name is N,N-dimethyl-3-phenacylsulfanylbenzamide.
| Compound Name | N,N-dimethyl-3-phenacylsulfanylbenzamide |
|---|---|
| PubChem CID | 84558154 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N,N-dimethyl-3-phenacylsulfanylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(SCC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H17NO2S/c1-18(2)17(20)14-9-6-10-15(11-14)21-12-16(19)13-7-4-3-5-8-13/h3-11H,12H2,1-2H3 |
| InChIKey | UFRCPLNEMNDSGS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |