C25H25NO3S — CID 84552635
N-[4-(2-methylpropoxy)phenyl]-3-phenacylsulfanylbenzamide (PubChem CID 84552635) has the molecular formula C25H25NO3S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[4-(2-methylpropoxy)phenyl]-3-phenacylsulfanylbenzamide.
| Compound Name | N-[4-(2-methylpropoxy)phenyl]-3-phenacylsulfanylbenzamide |
|---|---|
| PubChem CID | 84552635 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-[4-(2-methylpropoxy)phenyl]-3-phenacylsulfanylbenzamide |
| SMILES | CC(C)COc1ccc(NC(=O)c2cccc(SCC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H25NO3S/c1-18(2)16-29-22-13-11-21(12-14-22)26-25(28)20-9-6-10-23(15-20)30-17-24(27)19-7-4-3-5-8-19/h3-15,18H,16-17H2,1-2H3,(H,26,28) |
| InChIKey | CSQQQCVROMCLQO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |