C12H14N2O4S — CID 119368058
(2R)-2-[[2-(2-amino-2-oxoethyl)sulfanylacetyl]amino]-2-phenylacetic acid (PubChem CID 119368058) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is (2R)-2-[[2-(2-amino-2-oxoethyl)sulfanylacetyl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[2-(2-amino-2-oxoethyl)sulfanylacetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 119368058 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (2R)-2-[[2-(2-amino-2-oxoethyl)sulfanylacetyl]amino]-2-phenylacetic acid |
| SMILES | NC(=O)CSCC(=O)N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H14N2O4S/c13-9(15)6-19-7-10(16)14-11(12(17)18)8-4-2-1-3-5-8/h1-5,11H,6-7H2,(H2,13,15)(H,14,16)(H,17,18)/t11-/m1/s1 |
| InChIKey | MOEFAJKECKENTN-LLVKDONJSA-N |
| XLogP | 0.15 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |