C13H17NO5S2 — CID 107820283
(2S)-5-methoxy-5-oxo-2-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]pentanoic acid (PubChem CID 107820283) has the molecular formula C13H17NO5S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is (2S)-5-methoxy-5-oxo-2-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]pentanoic acid.
| Compound Name | (2S)-5-methoxy-5-oxo-2-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 107820283 |
| Molecular Formula | C13H17NO5S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | (2S)-5-methoxy-5-oxo-2-[[2-(thiophen-2-ylmethylsulfanyl)acetyl]amino]pentanoic acid |
| SMILES | COC(=O)CC[C@H](NC(=O)CSCc1cccs1)C(=O)O |
| InChI | InChI=1S/C13H17NO5S2/c1-19-12(16)5-4-10(13(17)18)14-11(15)8-20-7-9-3-2-6-21-9/h2-3,6,10H,4-5,7-8H2,1H3,(H,14,15)(H,17,18)/t10-/m0/s1 |
| InChIKey | FWTQZKYMNAAWPT-JTQLQIEISA-N |
| XLogP | 1.50 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |