C23H19FN2O5 — CID 2546824
2-(4-benzoylphenoxy)-N'-[2-(2-fluorophenoxy)acetyl]acetohydrazide (PubChem CID 2546824) has the molecular formula C23H19FN2O5 and a molecular weight of 422.41 g/mol. Its IUPAC name is 2-(4-benzoylphenoxy)-N'-[2-(2-fluorophenoxy)acetyl]acetohydrazide.
| Compound Name | 2-(4-benzoylphenoxy)-N'-[2-(2-fluorophenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 2546824 |
| Molecular Formula | C23H19FN2O5 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-(4-benzoylphenoxy)-N'-[2-(2-fluorophenoxy)acetyl]acetohydrazide |
| SMILES | O=C(COc1ccc(C(=O)c2ccccc2)cc1)NNC(=O)COc1ccccc1F |
| InChI | InChI=1S/C23H19FN2O5/c24-19-8-4-5-9-20(19)31-15-22(28)26-25-21(27)14-30-18-12-10-17(11-13-18)23(29)16-6-2-1-3-7-16/h1-13H,14-15H2,(H,25,27)(H,26,28) |
| InChIKey | AHFZJWPMCNJLCG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|