C23H19FN2O4 — CID 7795142
N-(benzylcarbamoyl)-2-[4-(4-fluorobenzoyl)phenoxy]acetamide (PubChem CID 7795142) has the molecular formula C23H19FN2O4 and a molecular weight of 406.41 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-2-[4-(4-fluorobenzoyl)phenoxy]acetamide.
| Compound Name | N-(benzylcarbamoyl)-2-[4-(4-fluorobenzoyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 7795142 |
| Molecular Formula | C23H19FN2O4 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-(benzylcarbamoyl)-2-[4-(4-fluorobenzoyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C(=O)c2ccc(F)cc2)cc1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H19FN2O4/c24-19-10-6-17(7-11-19)22(28)18-8-12-20(13-9-18)30-15-21(27)26-23(29)25-14-16-4-2-1-3-5-16/h1-13H,14-15H2,(H2,25,26,27,29) |
| InChIKey | GEQSHHPVQMIPQT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |