C22H18N2O3S — CID 4504563
2-[(2,2-diphenylacetyl)carbamothioylamino]benzoic acid (PubChem CID 4504563) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is 2-[(2,2-diphenylacetyl)carbamothioylamino]benzoic acid.
| Compound Name | 2-[(2,2-diphenylacetyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 4504563 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-[(2,2-diphenylacetyl)carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=S)NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18N2O3S/c25-20(24-22(28)23-18-14-8-7-13-17(18)21(26)27)19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19H,(H,26,27)(H2,23,24,25,28) |
| InChIKey | SJGXKCIAKKDZRK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|