C23H15N3O5S — CID 139229874
2-[[2-(1,3-dioxoisoindol-2-yl)benzoyl]carbamothioylamino]benzoic acid (PubChem CID 139229874) has the molecular formula C23H15N3O5S and a molecular weight of 445.46 g/mol. Its IUPAC name is 2-[[2-(1,3-dioxoisoindol-2-yl)benzoyl]carbamothioylamino]benzoic acid.
| Compound Name | 2-[[2-(1,3-dioxoisoindol-2-yl)benzoyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 139229874 |
| Molecular Formula | C23H15N3O5S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 2-[[2-(1,3-dioxoisoindol-2-yl)benzoyl]carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=S)NC(=O)c1ccccc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H15N3O5S/c27-19(25-23(32)24-17-11-5-3-9-15(17)22(30)31)16-10-4-6-12-18(16)26-20(28)13-7-1-2-8-14(13)21(26)29/h1-12H,(H,30,31)(H2,24,25,27,32) |
| InChIKey | IZNFSKCYNRLEQP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|