C16H13ClN2O3S — CID 58190030
2-[(2-chloro-5-methylbenzoyl)carbamothioylamino]benzoic acid (PubChem CID 58190030) has the molecular formula C16H13ClN2O3S and a molecular weight of 348.81 g/mol. Its IUPAC name is 2-[(2-chloro-5-methylbenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 2-[(2-chloro-5-methylbenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 58190030 |
| Molecular Formula | C16H13ClN2O3S |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-[(2-chloro-5-methylbenzoyl)carbamothioylamino]benzoic acid |
| SMILES | Cc1ccc(Cl)c(C(=O)NC(=S)Nc2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C16H13ClN2O3S/c1-9-6-7-12(17)11(8-9)14(20)19-16(23)18-13-5-3-2-4-10(13)15(21)22/h2-8H,1H3,(H,21,22)(H2,18,19,20,23) |
| InChIKey | MHOARJMWOHZKIR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|