C20H16ClN3OS — CID 1048122
N-[(5-chloro-2-pyridinyl)carbamothioyl]-2,2-diphenylacetamide (PubChem CID 1048122) has the molecular formula C20H16ClN3OS and a molecular weight of 381.89 g/mol. Its IUPAC name is N-[(5-chloro-2-pyridinyl)carbamothioyl]-2,2-diphenylacetamide.
| Compound Name | N-[(5-chloro-2-pyridinyl)carbamothioyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 1048122 |
| Molecular Formula | C20H16ClN3OS |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | N-[(5-chloro-2-pyridinyl)carbamothioyl]-2,2-diphenylacetamide |
| SMILES | O=C(NC(=S)Nc1ccc(Cl)cn1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16ClN3OS/c21-16-11-12-17(22-13-16)23-20(26)24-19(25)18(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,18H,(H2,22,23,24,25,26) |
| InChIKey | YDNYDYRDTYKGJX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|