C20H17N3OS — CID 920575
2,2-diphenyl-N-(pyridin-2-ylcarbamothioyl)acetamide (PubChem CID 920575) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is 2,2-diphenyl-N-(pyridin-2-ylcarbamothioyl)acetamide.
| Compound Name | 2,2-diphenyl-N-(pyridin-2-ylcarbamothioyl)acetamide |
|---|---|
| PubChem CID | 920575 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2,2-diphenyl-N-(pyridin-2-ylcarbamothioyl)acetamide |
| SMILES | O=C(NC(=S)Nc1ccccn1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H17N3OS/c24-19(23-20(25)22-17-13-7-8-14-21-17)18(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,18H,(H2,21,22,23,24,25) |
| InChIKey | OMHKQBYKBJBPHE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|