About pyridin-2-ylthiourea
pyridin-2-ylthiourea (PubChem CID 1490491) has the molecular formula C6H7N3S
and a molecular weight of 153.21 g/mol. Its IUPAC name is pyridin-2-ylthiourea.
Molecular Properties
| Compound Name | pyridin-2-ylthiourea |
| PubChem CID | 1490491 |
| Molecular Formula | C6H7N3S |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | pyridin-2-ylthiourea |
| SMILES | NC(=S)Nc1ccccn1 |
| InChI | InChI=1S/C6H7N3S/c7-6(10)9-5-3-1-2-4-8-5/h1-4H,(H3,7,8,9,10) |
| InChIKey | SLUHLANJIVXTRQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylthiourea?
The IUPAC name of pyridin-2-ylthiourea (CID 1490491) is pyridin-2-ylthiourea.
What is the SMILES notation for pyridin-2-ylthiourea?
The canonical SMILES for pyridin-2-ylthiourea is NC(=S)Nc1ccccn1.
What is the InChIKey of pyridin-2-ylthiourea?
The InChIKey is SLUHLANJIVXTRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3S/c7-6(10)9-5-3-1-2-4-8-5/h1-4H,(H3,7,8,9,10).
What are the key properties of pyridin-2-ylthiourea?
pyridin-2-ylthiourea has a molecular weight of 153.21 g/mol, XLogP of 0.74, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylthiourea is sourced from PubChem (CID 1490491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).