About (4-methyl-2-pyridinyl)thiourea;molecular nitrogen
(4-methyl-2-pyridinyl)thiourea;molecular nitrogen (PubChem CID 170549235) has the molecular formula C7H9N5S
and a molecular weight of 195.25 g/mol. Its IUPAC name is (4-methyl-2-pyridinyl)thiourea;molecular nitrogen.
Molecular Properties
| Compound Name | (4-methyl-2-pyridinyl)thiourea;molecular nitrogen |
| PubChem CID | 170549235 |
| Molecular Formula | C7H9N5S |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | (4-methyl-2-pyridinyl)thiourea;molecular nitrogen |
| SMILES | Cc1ccnc(NC(N)=S)c1.N#N |
| InChI | InChI=1S/C7H9N3S.N2/c1-5-2-3-9-6(4-5)10-7(8)11;1-2/h2-4H,1H3,(H3,8,9,10,11); |
| InChIKey | HYBLNGUMERSZKS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 98.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-2-pyridinyl)thiourea;molecular nitrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-2-pyridinyl)thiourea;molecular nitrogen?
The IUPAC name of (4-methyl-2-pyridinyl)thiourea;molecular nitrogen (CID 170549235) is (4-methyl-2-pyridinyl)thiourea;molecular nitrogen.
What is the SMILES notation for (4-methyl-2-pyridinyl)thiourea;molecular nitrogen?
The canonical SMILES for (4-methyl-2-pyridinyl)thiourea;molecular nitrogen is Cc1ccnc(NC(N)=S)c1.N#N.
What is the InChIKey of (4-methyl-2-pyridinyl)thiourea;molecular nitrogen?
The InChIKey is HYBLNGUMERSZKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3S.N2/c1-5-2-3-9-6(4-5)10-7(8)11;1-2/h2-4H,1H3,(H3,8,9,10,11);.
What are the key properties of (4-methyl-2-pyridinyl)thiourea;molecular nitrogen?
(4-methyl-2-pyridinyl)thiourea;molecular nitrogen has a molecular weight of 195.25 g/mol, XLogP of 1.08, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-2-pyridinyl)thiourea;molecular nitrogen is sourced from PubChem (CID 170549235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).